C10H14N2O — CID 123431617
2-(4-penta-1,3-dien-3-ylpyrazol-1-yl)ethanol (PubChem CID 123431617) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(4-penta-1,3-dien-3-ylpyrazol-1-yl)ethanol.
| Compound Name | 2-(4-penta-1,3-dien-3-ylpyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 123431617 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(4-penta-1,3-dien-3-ylpyrazol-1-yl)ethanol |
| SMILES | C=CC(=CC)c1cnn(CCO)c1 |
| InChI | InChI=1S/C10H14N2O/c1-3-9(4-2)10-7-11-12(8-10)5-6-13/h3-4,7-8,13H,1,5-6H2,2H3 |
| InChIKey | SPRRBZWFJHGPQM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|