C14H19FN2O — CID 156794361
4-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1-(2-methoxyethyl)pyrazole (PubChem CID 156794361) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1-(2-methoxyethyl)pyrazole.
| Compound Name | 4-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1-(2-methoxyethyl)pyrazole |
|---|---|
| PubChem CID | 156794361 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-[(2E,4E)-5-fluoro-6-methylhepta-2,4,6-trien-3-yl]-1-(2-methoxyethyl)pyrazole |
| SMILES | C=C(C)/C(F)=C\C(=C/C)c1cnn(CCOC)c1 |
| InChI | InChI=1S/C14H19FN2O/c1-5-12(8-14(15)11(2)3)13-9-16-17(10-13)6-7-18-4/h5,8-10H,2,6-7H2,1,3-4H3/b12-5+,14-8+ |
| InChIKey | PBWJFYXOUJABKV-YVZBBBOHSA-N |
| XLogP | 3.36 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|