C13H16F2N2 — CID 145090712
4-[(2E,4Z,6E)-3-(difluoromethyl)octa-2,4,6-trien-4-yl]-1-methylpyrazole (PubChem CID 145090712) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[(2E,4Z,6E)-3-(difluoromethyl)octa-2,4,6-trien-4-yl]-1-methylpyrazole.
| Compound Name | 4-[(2E,4Z,6E)-3-(difluoromethyl)octa-2,4,6-trien-4-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 145090712 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-[(2E,4Z,6E)-3-(difluoromethyl)octa-2,4,6-trien-4-yl]-1-methylpyrazole |
| SMILES | C/C=C/C=C(C(=C/C)\C(F)F)/c1cnn(C)c1 |
| InChI | InChI=1S/C13H16F2N2/c1-4-6-7-12(11(5-2)13(14)15)10-8-16-17(3)9-10/h4-9,13H,1-3H3/b6-4+,11-5+,12-7- |
| InChIKey | SQAGQTIPTBQAMS-OCGSPSLMSA-N |
| XLogP | 3.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|