C22H31BN3O3 — CID 123960665
CID 123960665 (PubChem CID 123960665) has the molecular formula C22H31BN3O3 and a molecular weight of 396.32 g/mol.
| Compound Name | CID 123960665 |
|---|---|
| PubChem CID | 123960665 |
| Molecular Formula | C22H31BN3O3 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(CC(C#N)NC(=O)C2(NC(=O)OC(C)(C)C)CCCCC2)cc1 |
| InChI | InChI=1S/C22H31BN3O3/c1-21(2,3)29-20(28)26-22(12-6-5-7-13-22)19(27)25-18(15-24)14-16-8-10-17(23-4)11-9-16/h8-11,18H,5-7,12-14H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | OEZRXINRBLALEX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|