C24H34N4O3S — CID 123962643
4-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)amino]-N-(3-methyl-9-bicyclo[3.3.1]non-1-enyl)pyrimidine-5-carboxamide (PubChem CID 123962643) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)amino]-N-(3-methyl-9-bicyclo[3.3.1]non-1-enyl)pyrimidine-5-carboxamide.
| Compound Name | 4-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)amino]-N-(3-methyl-9-bicyclo[3.3.1]non-1-enyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123962643 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 4-cyclopentyl-2-[(1,1-dioxothiolan-3-yl)amino]-N-(3-methyl-9-bicyclo[3.3.1]non-1-enyl)pyrimidine-5-carboxamide |
| SMILES | CC1C=C2CCCC(C1)C2NC(=O)c1cnc(NC2CCS(=O)(=O)C2)nc1C1CCCC1 |
| InChI | InChI=1S/C24H34N4O3S/c1-15-11-17-7-4-8-18(12-15)21(17)27-23(29)20-13-25-24(26-19-9-10-32(30,31)14-19)28-22(20)16-5-2-3-6-16/h11,13,15-16,18-19,21H,2-10,12,14H2,1H3,(H,27,29)(H,25,26,28) |
| InChIKey | SHUVJCXBMTVVBU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|