C26H26FN3O2 — CID 123962828
3-[4-[2-(4-fluorophenyl)-6-methoxy-1-methyl-3,4-dihydroisoquinolin-1-yl]phenyl]-N-iminopropanamide (PubChem CID 123962828) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-[4-[2-(4-fluorophenyl)-6-methoxy-1-methyl-3,4-dihydroisoquinolin-1-yl]phenyl]-N-iminopropanamide.
| Compound Name | 3-[4-[2-(4-fluorophenyl)-6-methoxy-1-methyl-3,4-dihydroisoquinolin-1-yl]phenyl]-N-iminopropanamide |
|---|---|
| PubChem CID | 123962828 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-[4-[2-(4-fluorophenyl)-6-methoxy-1-methyl-3,4-dihydroisoquinolin-1-yl]phenyl]-N-iminopropanamide |
| SMILES | [H]/N=N/C(=O)CCc1ccc(C2(C)c3ccc(OC)cc3CCN2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H26FN3O2/c1-26(20-6-3-18(4-7-20)5-14-25(31)29-28)24-13-12-23(32-2)17-19(24)15-16-30(26)22-10-8-21(27)9-11-22/h3-4,6-13,17,28H,5,14-16H2,1-2H3/b29-28+ |
| InChIKey | QLNDFARBKLJMOY-ZQHSETAFSA-N |
| XLogP | 5.65 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|