C18H16FNO3 — CID 123963578
3-ethyl-2-(3-fluorophenyl)-6-hydroxy-1-methylindole-5-carboxylic acid (PubChem CID 123963578) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-ethyl-2-(3-fluorophenyl)-6-hydroxy-1-methylindole-5-carboxylic acid.
| Compound Name | 3-ethyl-2-(3-fluorophenyl)-6-hydroxy-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 123963578 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-ethyl-2-(3-fluorophenyl)-6-hydroxy-1-methylindole-5-carboxylic acid |
| SMILES | CCc1c(-c2cccc(F)c2)n(C)c2cc(O)c(C(=O)O)cc12 |
| InChI | InChI=1S/C18H16FNO3/c1-3-12-13-8-14(18(22)23)16(21)9-15(13)20(2)17(12)10-5-4-6-11(19)7-10/h4-9,21H,3H2,1-2H3,(H,22,23) |
| InChIKey | ABYHJIHXXANJDJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |