C18H13IN2O6 — CID 141416230
2-[3-(carboxycarbamoyl)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylic acid (PubChem CID 141416230) has the molecular formula C18H13IN2O6 and a molecular weight of 480.21 g/mol. Its IUPAC name is 2-[3-(carboxycarbamoyl)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylic acid.
| Compound Name | 2-[3-(carboxycarbamoyl)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 141416230 |
| Molecular Formula | C18H13IN2O6 |
| Molecular Weight | 480.21 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 2-[3-(carboxycarbamoyl)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylic acid |
| SMILES | Cn1c(-c2cccc(C(=O)NC(=O)O)c2)c(I)c2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C18H13IN2O6/c1-21-12-7-13(22)11(17(24)25)6-10(12)14(19)15(21)8-3-2-4-9(5-8)16(23)20-18(26)27/h2-7,22H,1H3,(H,20,23)(H,24,25)(H,26,27) |
| InChIKey | OEQTVCHKAZYHRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|