C20H22ClN3O — CID 123964638
1-(3-chlorophenyl)-2-(cyclopropylmethylamino)-2-(1-methylbenzimidazol-2-yl)ethanol (PubChem CID 123964638) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(cyclopropylmethylamino)-2-(1-methylbenzimidazol-2-yl)ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-(cyclopropylmethylamino)-2-(1-methylbenzimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 123964638 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(cyclopropylmethylamino)-2-(1-methylbenzimidazol-2-yl)ethanol |
| SMILES | Cn1c(C(NCC2CC2)C(O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H22ClN3O/c1-24-17-8-3-2-7-16(17)23-20(24)18(22-12-13-9-10-13)19(25)14-5-4-6-15(21)11-14/h2-8,11,13,18-19,22,25H,9-10,12H2,1H3 |
| InChIKey | LFJDDBKTDUXRCW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |