C13H23+ — CID 123965965
(4Z)-3,5-diethyl-6-methylocta-1,4-diene (PubChem CID 123965965) has the molecular formula C13H23+ and a molecular weight of 179.33 g/mol. Its IUPAC name is (4Z)-3,5-diethyl-6-methylocta-1,4-diene.
| Compound Name | (4Z)-3,5-diethyl-6-methylocta-1,4-diene |
|---|---|
| PubChem CID | 123965965 |
| Molecular Formula | C13H23+ |
| Molecular Weight | 179.33 g/mol |
| Exact Mass | 179.18 |
| IUPAC Name | (4Z)-3,5-diethyl-6-methylocta-1,4-diene |
| SMILES | C=[C+]C(/C=C(/CC)C(C)CC)CC |
| InChI | InChI=1S/C13H23/c1-6-11(5)13(9-4)10-12(7-2)8-3/h10-12H,2,6,8-9H2,1,3-5H3/q+1/b13-10- |
| InChIKey | DXMKAHZBKOWQCG-RAXLEYEMSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|