C23H28N2O3 — CID 123968146
3-[4-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methyl]piperazin-1-yl]prop-2-enal (PubChem CID 123968146) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[4-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methyl]piperazin-1-yl]prop-2-enal.
| Compound Name | 3-[4-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methyl]piperazin-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 123968146 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[4-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methyl]piperazin-1-yl]prop-2-enal |
| SMILES | COc1ccc(CCOc2ccc(CN3CCN(C=CC=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-27-22-7-3-20(4-8-22)11-18-28-23-9-5-21(6-10-23)19-25-15-13-24(14-16-25)12-2-17-26/h2-10,12,17H,11,13-16,18-19H2,1H3 |
| InChIKey | MEWKNXADDQEOEA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|