C21H28BNO4 — CID 123970486
(1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(2-phenylethenyl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123970486) has the molecular formula C21H28BNO4 and a molecular weight of 369.27 g/mol. Its IUPAC name is (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(2-phenylethenyl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(2-phenylethenyl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123970486 |
| Molecular Formula | C21H28BNO4 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(2-phenylethenyl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | CC(C1CCCCC1)[N@+]12CC(=O)C(C1)C(=O)O[B-]2(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C21H28BNO4/c1-16(18-10-6-3-7-11-18)23-14-19(20(24)15-23)21(25)27-22(23,26)13-12-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,16,18-19,26H,3,6-7,10-11,14-15H2,1H3/t16?,19?,22?,23-/m1/s1 |
| InChIKey | AKULEUISFOBYPR-BEQRQZMESA-N |
| XLogP | 2.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|