C31H54O2 — CID 123971445
4,7-dimethyl-1-[(2S)-3-(4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-(2-methyl-1-propan-2-yloxyprop-1-enoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 123971445) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is 4,7-dimethyl-1-[(2S)-3-(4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-(2-methyl-1-propan-2-yloxyprop-1-enoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 4,7-dimethyl-1-[(2S)-3-(4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-(2-methyl-1-propan-2-yloxyprop-1-enoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 123971445 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | 4,7-dimethyl-1-[(2S)-3-(4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-(2-methyl-1-propan-2-yloxyprop-1-enoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC(C)=C(OC(C)C)O[C@@H](CC1CCC2C(C)CCCC12)CC1CCC2C(C)CCC(C)C12 |
| InChI | InChI=1S/C31H54O2/c1-19(2)31(32-20(3)4)33-26(17-24-13-15-27-21(5)9-8-10-29(24)27)18-25-14-16-28-22(6)11-12-23(7)30(25)28/h20-30H,8-18H2,1-7H3/t21?,22?,23?,24?,25?,26-,27?,28?,29?,30?/m0/s1 |
| InChIKey | OXTGHEIXIQGTSP-CTNPLZCBSA-N |
| XLogP | 9.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|