C9H18N2 — CID 123972243
(Z)-3-imino-N,N,4-trimethylhex-1-en-1-amine (PubChem CID 123972243) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-3-imino-N,N,4-trimethylhex-1-en-1-amine.
| Compound Name | (Z)-3-imino-N,N,4-trimethylhex-1-en-1-amine |
|---|---|
| PubChem CID | 123972243 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-3-imino-N,N,4-trimethylhex-1-en-1-amine |
| SMILES | [H]/N=C(/C=C\N(C)C)C(C)CC |
| InChI | InChI=1S/C9H18N2/c1-5-8(2)9(10)6-7-11(3)4/h6-8,10H,5H2,1-4H3/b7-6-,10-9- |
| InChIKey | VOGPPRYZMGXOFZ-HZJYTTRNSA-N |
| XLogP | 2.13 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|