C13H21N3 — CID 123972302
8-piperazin-1-yl-2,3,5,6,7,8-hexahydroquinoline (PubChem CID 123972302) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 8-piperazin-1-yl-2,3,5,6,7,8-hexahydroquinoline.
| Compound Name | 8-piperazin-1-yl-2,3,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 123972302 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 8-piperazin-1-yl-2,3,5,6,7,8-hexahydroquinoline |
| SMILES | C1=C2CCCC(N3CCNCC3)C2=NCC1 |
| InChI | InChI=1S/C13H21N3/c1-3-11-4-2-6-15-13(11)12(5-1)16-9-7-14-8-10-16/h4,12,14H,1-3,5-10H2 |
| InChIKey | QIIPUKQZJVHANO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |