C8H12N2O3 — CID 123972436
N-butan-2-yl-3-oxo-1,2-oxazole-4-carboxamide (PubChem CID 123972436) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is N-butan-2-yl-3-oxo-1,2-oxazole-4-carboxamide.
| Compound Name | N-butan-2-yl-3-oxo-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 123972436 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-butan-2-yl-3-oxo-1,2-oxazole-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1co[nH]c1=O |
| InChI | InChI=1S/C8H12N2O3/c1-3-5(2)9-7(11)6-4-13-10-8(6)12/h4-5H,3H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | SMXSRZURKFIYBP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |