C8H12ClN — CID 123973209
(5Z)-1-chloroocta-5,7-dien-4-imine (PubChem CID 123973209) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is (5Z)-1-chloroocta-5,7-dien-4-imine.
| Compound Name | (5Z)-1-chloroocta-5,7-dien-4-imine |
|---|---|
| PubChem CID | 123973209 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (5Z)-1-chloroocta-5,7-dien-4-imine |
| SMILES | [H]/N=C(/C=C\C=C)CCCCl |
| InChI | InChI=1S/C8H12ClN/c1-2-3-5-8(10)6-4-7-9/h2-3,5,10H,1,4,6-7H2/b5-3-,10-8- |
| InChIKey | DRZQJCGIYPDZGR-PGNVZPTMSA-N |
| XLogP | 2.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|