C19H17ClN4O3S — CID 123974182
[6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]methyl methanesulfonate (PubChem CID 123974182) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]methyl methanesulfonate.
| Compound Name | [6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 123974182 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]methyl methanesulfonate |
| SMILES | Cc1nnc2n1-c1ccccc1C(c1ccc(Cl)cc1)=NC2COS(C)(=O)=O |
| InChI | InChI=1S/C19H17ClN4O3S/c1-12-22-23-19-16(11-27-28(2,25)26)21-18(13-7-9-14(20)10-8-13)15-5-3-4-6-17(15)24(12)19/h3-10,16H,11H2,1-2H3 |
| InChIKey | MUDVJENLGFMHCJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|