C4H10N6 — CID 123974261
N"-(2H-triazol-4-ylmethyl)methanetriamine (PubChem CID 123974261) has the molecular formula C4H10N6 and a molecular weight of 142.17 g/mol. Its IUPAC name is N"-(2H-triazol-4-ylmethyl)methanetriamine.
| Compound Name | N"-(2H-triazol-4-ylmethyl)methanetriamine |
|---|---|
| PubChem CID | 123974261 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | N"-(2H-triazol-4-ylmethyl)methanetriamine |
| SMILES | NC(N)NCc1cn[nH]n1 |
| InChI | InChI=1S/C4H10N6/c5-4(6)7-1-3-2-8-10-9-3/h2,4,7H,1,5-6H2,(H,8,9,10) |
| InChIKey | CZGMYPNQSFMSJC-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|