C17H10Cl2F2N4O3S — CID 123975611
3-[4-(2-chlorophenyl)-5-(5-methylsulfonyl-2-pyridinyl)-1,2,4-triazol-3-yl]-2,3-difluoroprop-2-enoyl chloride (PubChem CID 123975611) has the molecular formula C17H10Cl2F2N4O3S and a molecular weight of 459.26 g/mol. Its IUPAC name is 3-[4-(2-chlorophenyl)-5-(5-methylsulfonyl-2-pyridinyl)-1,2,4-triazol-3-yl]-2,3-difluoroprop-2-enoyl chloride.
| Compound Name | 3-[4-(2-chlorophenyl)-5-(5-methylsulfonyl-2-pyridinyl)-1,2,4-triazol-3-yl]-2,3-difluoroprop-2-enoyl chloride |
|---|---|
| PubChem CID | 123975611 |
| Molecular Formula | C17H10Cl2F2N4O3S |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 3-[4-(2-chlorophenyl)-5-(5-methylsulfonyl-2-pyridinyl)-1,2,4-triazol-3-yl]-2,3-difluoroprop-2-enoyl chloride |
| SMILES | CS(=O)(=O)c1ccc(-c2nnc(C(F)=C(F)C(=O)Cl)n2-c2ccccc2Cl)nc1 |
| InChI | InChI=1S/C17H10Cl2F2N4O3S/c1-29(27,28)9-6-7-11(22-8-9)16-23-24-17(14(21)13(20)15(19)26)25(16)12-5-3-2-4-10(12)18/h2-8H,1H3 |
| InChIKey | VCUSULFMHORGRO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|