C18H10ClF3N4O3 — CID 67968000
(E)-3-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroacetyl)-2-pyridinyl]-1,2,4-triazol-3-yl]prop-2-enoic acid (PubChem CID 67968000) has the molecular formula C18H10ClF3N4O3 and a molecular weight of 422.75 g/mol. Its IUPAC name is (E)-3-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroacetyl)-2-pyridinyl]-1,2,4-triazol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroacetyl)-2-pyridinyl]-1,2,4-triazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67968000 |
| Molecular Formula | C18H10ClF3N4O3 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (E)-3-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroacetyl)-2-pyridinyl]-1,2,4-triazol-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(-c2ccc(C(=O)C(F)(F)F)cn2)n1-c1ccccc1Cl |
| InChI | InChI=1S/C18H10ClF3N4O3/c19-11-3-1-2-4-13(11)26-14(7-8-15(27)28)24-25-17(26)12-6-5-10(9-23-12)16(29)18(20,21)22/h1-9H,(H,27,28)/b8-7+ |
| InChIKey | QOZQSXSTWZGTKM-BQYQJAHWSA-N |
| XLogP | 3.83 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|