C20H14ClF3N4O4 — CID 67337188
3-[4-[[2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxyacetyl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 67337188) has the molecular formula C20H14ClF3N4O4 and a molecular weight of 466.80 g/mol. Its IUPAC name is 3-[4-[[2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxyacetyl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxyacetyl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67337188 |
| Molecular Formula | C20H14ClF3N4O4 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 3-[4-[[2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxyacetyl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnccc1NC(=O)COc1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C20H14ClF3N4O4/c21-13-3-1-2-4-15(13)28-18(9-16(27-28)20(22,23)24)32-11-17(29)26-14-7-8-25-10-12(14)5-6-19(30)31/h1-10H,11H2,(H,30,31)(H,25,26,29) |
| InChIKey | KAJNPWXFFZUUQI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|