C21H13ClF9N3O3 — CID 57458369
2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide (PubChem CID 57458369) has the molecular formula C21H13ClF9N3O3 and a molecular weight of 561.79 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide.
| Compound Name | 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 57458369 |
| Molecular Formula | C21H13ClF9N3O3 |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)nn1-c1ccccc1Cl)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13ClF9N3O3/c22-13-3-1-2-4-14(13)34-17(9-15(33-34)19(23,24)25)37-10-16(35)32-12-7-5-11(6-8-12)18(36,20(26,27)28)21(29,30)31/h1-9,36H,10H2,(H,32,35) |
| InChIKey | QLNFVLFOTIINLU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |