C18H10BCl2F4N3O2 — CID 90149290
CID 90149290 (PubChem CID 90149290) has the molecular formula C18H10BCl2F4N3O2 and a molecular weight of 458.01 g/mol.
| Compound Name | CID 90149290 |
|---|---|
| PubChem CID | 90149290 |
| Molecular Formula | C18H10BCl2F4N3O2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)cc(Cl)c1NC(=O)COc1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C18H10BCl2F4N3O2/c19-10-5-9(22)6-12(21)17(10)26-15(29)8-30-16-7-14(18(23,24)25)27-28(16)13-4-2-1-3-11(13)20/h1-7H,8H2,(H,26,29) |
| InChIKey | OUSMEWMOVRSRHU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|