C15H31N2Si+ — CID 123975647
4,6-dimethyl-1,3-dipentyl-2H-1,3,2-diazasilin-1-ium (PubChem CID 123975647) has the molecular formula C15H31N2Si+ and a molecular weight of 267.51 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-dipentyl-2H-1,3,2-diazasilin-1-ium.
| Compound Name | 4,6-dimethyl-1,3-dipentyl-2H-1,3,2-diazasilin-1-ium |
|---|---|
| PubChem CID | 123975647 |
| Molecular Formula | C15H31N2Si+ |
| Molecular Weight | 267.51 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 4,6-dimethyl-1,3-dipentyl-2H-1,3,2-diazasilin-1-ium |
| SMILES | CCCCCN1[SiH2][N+](CCCCC)=C(C)C=C1C |
| InChI | InChI=1S/C15H31N2Si/c1-5-7-9-11-16-14(3)13-15(4)17(18-16)12-10-8-6-2/h13H,5-12,18H2,1-4H3/q+1 |
| InChIKey | CDIHRFYFIDMOSR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|