C32H53O9P — CID 123976743
(22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) dihydrogen phosphate (PubChem CID 123976743) has the molecular formula C32H53O9P and a molecular weight of 612.74 g/mol. Its IUPAC name is (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) dihydrogen phosphate.
| Compound Name | (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 123976743 |
| Molecular Formula | C32H53O9P |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) dihydrogen phosphate |
| SMILES | C=CC=CC(C)C1OC(=O)C=CC=CC(C)C(O)CC(OP(=O)(O)O)C=CC(C)C(O)C(C)CC(C)CCC(O)C1C |
| InChI | InChI=1S/C32H53O9P/c1-8-9-12-24(5)32-26(7)28(33)18-15-21(2)19-25(6)31(36)23(4)16-17-27(41-42(37,38)39)20-29(34)22(3)13-10-11-14-30(35)40-32/h8-14,16-17,21-29,31-34,36H,1,15,18-20H2,2-7H3,(H2,37,38,39) |
| InChIKey | XDGHMZUSXOYJDI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|