C42H60O7 — CID 123266316
10-[[4-(cyclopropen-1-yloxy)phenyl]methoxy]-22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-1-oxacyclodocosa-3,5,11-trien-2-one (PubChem CID 123266316) has the molecular formula C42H60O7 and a molecular weight of 676.94 g/mol. Its IUPAC name is 10-[[4-(cyclopropen-1-yloxy)phenyl]methoxy]-22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-1-oxacyclodocosa-3,5,11-trien-2-one.
| Compound Name | 10-[[4-(cyclopropen-1-yloxy)phenyl]methoxy]-22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-1-oxacyclodocosa-3,5,11-trien-2-one |
|---|---|
| PubChem CID | 123266316 |
| Molecular Formula | C42H60O7 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.43 |
| IUPAC Name | 10-[[4-(cyclopropen-1-yloxy)phenyl]methoxy]-22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-1-oxacyclodocosa-3,5,11-trien-2-one |
| SMILES | C=CC=CC(C)C1OC(=O)C=CC=CC(C)C(O)CC(OCc2ccc(OC3=CC3)cc2)C=CC(C)C(O)C(C)CC(C)CCC(O)C1C |
| InChI | InChI=1S/C42H60O7/c1-8-9-12-31(5)42-33(7)38(43)24-15-28(2)25-32(6)41(46)30(4)16-19-37(26-39(44)29(3)13-10-11-14-40(45)49-42)47-27-34-17-20-35(21-18-34)48-36-22-23-36/h8-14,16-22,28-33,37-39,41-44,46H,1,15,23-27H2,2-7H3 |
| InChIKey | CTHIOUYKNMTFTB-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|