C24H21N5OS — CID 123977127
cyclohexyl-[3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]methanone (PubChem CID 123977127) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is cyclohexyl-[3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]methanone.
| Compound Name | cyclohexyl-[3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]methanone |
|---|---|
| PubChem CID | 123977127 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | cyclohexyl-[3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]methanone |
| SMILES | [C-]#[N+]c1ccccc1CSc1nnc2c3ccccc3n(C(=O)C3CCCCC3)c2n1 |
| InChI | InChI=1S/C24H21N5OS/c1-25-19-13-7-5-11-17(19)15-31-24-26-22-21(27-28-24)18-12-6-8-14-20(18)29(22)23(30)16-9-3-2-4-10-16/h5-8,11-14,16H,2-4,9-10,15H2 |
| InChIKey | CEIDXFJBEPVZOW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|