C26H22ClN5S — CID 123977281
6-(1,3-benzothiazol-6-yl)-N-[1-[3-(6-chloro-5-methyl-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine (PubChem CID 123977281) has the molecular formula C26H22ClN5S and a molecular weight of 472.02 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-yl)-N-[1-[3-(6-chloro-5-methyl-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(1,3-benzothiazol-6-yl)-N-[1-[3-(6-chloro-5-methyl-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 123977281 |
| Molecular Formula | C26H22ClN5S |
| Molecular Weight | 472.02 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 6-(1,3-benzothiazol-6-yl)-N-[1-[3-(6-chloro-5-methyl-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NC(C)c2cccc(-c3cnc(Cl)c(C)c3)c2)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C26H22ClN5S/c1-15-9-21(13-28-26(15)27)19-6-4-5-18(10-19)16(2)30-25-12-23(31-17(3)32-25)20-7-8-22-24(11-20)33-14-29-22/h4-14,16H,1-3H3,(H,30,31,32) |
| InChIKey | XNOBIPCDNGRSBM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.02 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|