C25H20FN5S — CID 127036126
6-(1,3-benzothiazol-6-yl)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine (PubChem CID 127036126) has the molecular formula C25H20FN5S and a molecular weight of 441.54 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-yl)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(1,3-benzothiazol-6-yl)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 127036126 |
| Molecular Formula | C25H20FN5S |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 6-(1,3-benzothiazol-6-yl)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(N[C@@H](C)c2cccc(-c3ccc(F)nc3)c2)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C25H20FN5S/c1-15(17-4-3-5-18(10-17)20-7-9-24(26)27-13-20)29-25-12-22(30-16(2)31-25)19-6-8-21-23(11-19)32-14-28-21/h3-15H,1-2H3,(H,29,30,31)/t15-/m0/s1 |
| InChIKey | SLSKBXUMSCROAW-HNNXBMFYSA-N |
| XLogP | 6.44 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|