C13H10BrNOS — CID 123977738
(5R)-3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole (PubChem CID 123977738) has the molecular formula C13H10BrNOS and a molecular weight of 308.20 g/mol. Its IUPAC name is (5R)-3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 123977738 |
| Molecular Formula | C13H10BrNOS |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | (5R)-3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole |
| SMILES | BrC1=C[C@H](c2cc(-c3ccccc3)cs2)ON1 |
| InChI | InChI=1S/C13H10BrNOS/c14-13-7-11(16-15-13)12-6-10(8-17-12)9-4-2-1-3-5-9/h1-8,11,15H/t11-/m1/s1 |
| InChIKey | RHPQXOXPKKGWID-LLVKDONJSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|