C9H14ClNO2 — CID 123978891
4-chloro-5,7,7-trimethylazepane-2,6-dione (PubChem CID 123978891) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 4-chloro-5,7,7-trimethylazepane-2,6-dione.
| Compound Name | 4-chloro-5,7,7-trimethylazepane-2,6-dione |
|---|---|
| PubChem CID | 123978891 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-chloro-5,7,7-trimethylazepane-2,6-dione |
| SMILES | CC1C(=O)C(C)(C)NC(=O)CC1Cl |
| InChI | InChI=1S/C9H14ClNO2/c1-5-6(10)4-7(12)11-9(2,3)8(5)13/h5-6H,4H2,1-3H3,(H,11,12) |
| InChIKey | CZIRJXNGJINMJH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|