C7H14N2O — CID 138039752
4-(aminomethyl)-5,5-dimethylpyrrolidin-2-one (PubChem CID 138039752) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-(aminomethyl)-5,5-dimethylpyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-5,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 138039752 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4-(aminomethyl)-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)NC(=O)CC1CN |
| InChI | InChI=1S/C7H14N2O/c1-7(2)5(4-8)3-6(10)9-7/h5H,3-4,8H2,1-2H3,(H,9,10) |
| InChIKey | XJQLVIKGRVQFKR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |