3,3-dimethyl-5-oxopiperazine-2-carboxylic acid

C7H12N2O3 — CID 154319520

IUPAC3,3-dimethyl-5-oxopiperazine-2-carboxylic acid
SMILESCC1(C)NC(=O)CNC1C(=O)O
InChIInChI=1S/C7H12N2O3/c1-7(2)5(6(11)12)8-3-4(10)9-7/h5,8H,3H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyNYIRYIRUUUGKTE-UHFFFAOYSA-N
MW172.18 g/mol
LogP-1.06
Rot. Bonds1

About 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid

3,3-dimethyl-5-oxopiperazine-2-carboxylic acid (PubChem CID 154319520) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid.

Molecular Properties

Compound Name3,3-dimethyl-5-oxopiperazine-2-carboxylic acid
PubChem CID154319520
Molecular FormulaC7H12N2O3
Molecular Weight172.18 g/mol
Exact Mass172.08
IUPAC Name3,3-dimethyl-5-oxopiperazine-2-carboxylic acid
SMILESCC1(C)NC(=O)CNC1C(=O)O
InChIInChI=1S/C7H12N2O3/c1-7(2)5(6(11)12)8-3-4(10)9-7/h5,8H,3H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyNYIRYIRUUUGKTE-UHFFFAOYSA-N
XLogP-1.06
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.18
LogP ≤ 5-1.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid?
The IUPAC name of 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid (CID 154319520) is 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid.
What is the SMILES notation for 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid?
The canonical SMILES for 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid is CC1(C)NC(=O)CNC1C(=O)O.
What is the InChIKey of 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid?
The InChIKey is NYIRYIRUUUGKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-7(2)5(6(11)12)8-3-4(10)9-7/h5,8H,3H2,1-2H3,(H,9,10)(H,11,12).
What are the key properties of 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid?
3,3-dimethyl-5-oxopiperazine-2-carboxylic acid has a molecular weight of 172.18 g/mol, XLogP of -1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-5-oxopiperazine-2-carboxylic acid is sourced from PubChem (CID 154319520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).