C33H36F5N5O4 — CID 123979925
ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate (PubChem CID 123979925) has the molecular formula C33H36F5N5O4 and a molecular weight of 661.67 g/mol. Its IUPAC name is ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate |
|---|---|
| PubChem CID | 123979925 |
| Molecular Formula | C33H36F5N5O4 |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(Oc3c(F)c(F)c(F)c(F)c3F)nc(N(COC(C)(C)C)Cc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C33H36F5N5O4/c1-5-45-22(44)16-42-17-39-28-30(42)40-32(41-31(28)47-29-26(37)24(35)23(34)25(36)27(29)38)43(18-46-33(2,3)4)15-19-11-13-21(14-12-19)20-9-7-6-8-10-20/h11-14,17,20H,5-10,15-16,18H2,1-4H3 |
| InChIKey | CDJIZOWNPZFIQC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|