C20H19N — CID 123980064
(3E)-4-(9H-fluoren-2-yl)hepta-3,5-dien-2-imine (PubChem CID 123980064) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is (3E)-4-(9H-fluoren-2-yl)hepta-3,5-dien-2-imine.
| Compound Name | (3E)-4-(9H-fluoren-2-yl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123980064 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3E)-4-(9H-fluoren-2-yl)hepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C(\C=CC)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C20H19N/c1-3-6-15(11-14(2)21)16-9-10-20-18(12-16)13-17-7-4-5-8-19(17)20/h3-12,21H,13H2,1-2H3/b6-3?,15-11+,21-14+ |
| InChIKey | ZZCDJYUKACDWIU-QNLNIBJNSA-N |
| XLogP | 5.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|