C24H30N2O4 — CID 123980132
[2-[4-(3,4-dihydroxyphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl]-morpholin-4-ylmethanone (PubChem CID 123980132) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-[4-(3,4-dihydroxyphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[4-(3,4-dihydroxyphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 123980132 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-[4-(3,4-dihydroxyphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)(CCc1ccc(O)c(O)c1)N1Cc2cccc(C(=O)N3CCOCC3)c2C1 |
| InChI | InChI=1S/C24H30N2O4/c1-24(2,9-8-17-6-7-21(27)22(28)14-17)26-15-18-4-3-5-19(20(18)16-26)23(29)25-10-12-30-13-11-25/h3-7,14,27-28H,8-13,15-16H2,1-2H3 |
| InChIKey | IOLARIXDPGZYSR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|