C24H32N2O4 — CID 118283024
2-[4-(4-hydroxy-3-methoxyphenyl)-2-methylbutan-2-yl]-N-(2-methoxyethyl)-1,3-dihydroisoindole-4-carboxamide (PubChem CID 118283024) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3-methoxyphenyl)-2-methylbutan-2-yl]-N-(2-methoxyethyl)-1,3-dihydroisoindole-4-carboxamide.
| Compound Name | 2-[4-(4-hydroxy-3-methoxyphenyl)-2-methylbutan-2-yl]-N-(2-methoxyethyl)-1,3-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 118283024 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[4-(4-hydroxy-3-methoxyphenyl)-2-methylbutan-2-yl]-N-(2-methoxyethyl)-1,3-dihydroisoindole-4-carboxamide |
| SMILES | COCCNC(=O)c1cccc2c1CN(C(C)(C)CCc1ccc(O)c(OC)c1)C2 |
| InChI | InChI=1S/C24H32N2O4/c1-24(2,11-10-17-8-9-21(27)22(14-17)30-4)26-15-18-6-5-7-19(20(18)16-26)23(28)25-12-13-29-3/h5-9,14,27H,10-13,15-16H2,1-4H3,(H,25,28) |
| InChIKey | HEPHASPZCGRUAG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|