C21H22F3NO4 — CID 139208783
[2-[4-[4-hydroxy-3-(trifluoromethoxy)phenyl]-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate (PubChem CID 139208783) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is [2-[4-[4-hydroxy-3-(trifluoromethoxy)phenyl]-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate.
| Compound Name | [2-[4-[4-hydroxy-3-(trifluoromethoxy)phenyl]-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate |
|---|---|
| PubChem CID | 139208783 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-[4-[4-hydroxy-3-(trifluoromethoxy)phenyl]-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate |
| SMILES | CC(C)(CCc1ccc(O)c(OC(F)(F)F)c1)N1Cc2cccc(OC=O)c2C1 |
| InChI | InChI=1S/C21H22F3NO4/c1-20(2,25-11-15-4-3-5-18(28-13-26)16(15)12-25)9-8-14-6-7-17(27)19(10-14)29-21(22,23)24/h3-7,10,13,27H,8-9,11-12H2,1-2H3 |
| InChIKey | SUYTVIUCSRBZAG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|