C21H25NO3 — CID 129155623
[2-[4-(4-hydroxy-3-methylphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate (PubChem CID 129155623) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is [2-[4-(4-hydroxy-3-methylphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate.
| Compound Name | [2-[4-(4-hydroxy-3-methylphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate |
|---|---|
| PubChem CID | 129155623 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [2-[4-(4-hydroxy-3-methylphenyl)-2-methylbutan-2-yl]-1,3-dihydroisoindol-4-yl] formate |
| SMILES | Cc1cc(CCC(C)(C)N2Cc3cccc(OC=O)c3C2)ccc1O |
| InChI | InChI=1S/C21H25NO3/c1-15-11-16(7-8-19(15)24)9-10-21(2,3)22-12-17-5-4-6-20(25-14-23)18(17)13-22/h4-8,11,14,24H,9-10,12-13H2,1-3H3 |
| InChIKey | HJLKMHWQLVEUDF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|