C22H29NO2S — CID 165134934
2-methoxy-4-[3-methyl-3-[4-[methyl(methylidene)-λ4-sulfanyl]-1,3-dihydroisoindol-2-yl]butyl]phenol (PubChem CID 165134934) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-methoxy-4-[3-methyl-3-[4-[methyl(methylidene)-λ4-sulfanyl]-1,3-dihydroisoindol-2-yl]butyl]phenol.
| Compound Name | 2-methoxy-4-[3-methyl-3-[4-[methyl(methylidene)-λ4-sulfanyl]-1,3-dihydroisoindol-2-yl]butyl]phenol |
|---|---|
| PubChem CID | 165134934 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-methoxy-4-[3-methyl-3-[4-[methyl(methylidene)-λ4-sulfanyl]-1,3-dihydroisoindol-2-yl]butyl]phenol |
| SMILES | C=S(C)c1cccc2c1CN(C(C)(C)CCc1ccc(O)c(OC)c1)C2 |
| InChI | InChI=1S/C22H29NO2S/c1-22(2,12-11-16-9-10-19(24)20(13-16)25-3)23-14-17-7-6-8-21(26(4)5)18(17)15-23/h6-10,13,24H,4,11-12,14-15H2,1-3,5H3 |
| InChIKey | OOWAXDDOHWRZSS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|