C8H13NS — CID 123981750
methyl N-hexa-1,3-dien-2-ylmethanimidothioate (PubChem CID 123981750) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is methyl N-hexa-1,3-dien-2-ylmethanimidothioate.
| Compound Name | methyl N-hexa-1,3-dien-2-ylmethanimidothioate |
|---|---|
| PubChem CID | 123981750 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | methyl N-hexa-1,3-dien-2-ylmethanimidothioate |
| SMILES | C=C(C=CCC)/N=C/SC |
| InChI | InChI=1S/C8H13NS/c1-4-5-6-8(2)9-7-10-3/h5-7H,2,4H2,1,3H3/b6-5?,9-7+ |
| InChIKey | PYEYDUNDNZJZTD-VFEDGGCQSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|