methyl N-hexa-1,3-dien-2-ylmethanimidothioate

C8H13NS — CID 123981750

IUPACmethyl N-hexa-1,3-dien-2-ylmethanimidothioate
SMILESC=C(C=CCC)/N=C/SC
InChIInChI=1S/C8H13NS/c1-4-5-6-8(2)9-7-10-3/h5-7H,2,4H2,1,3H3/b6-5?,9-7+
InChIKeyPYEYDUNDNZJZTD-VFEDGGCQSA-N
MW155.27 g/mol
LogP2.86
Rot. Bonds4

About methyl N-hexa-1,3-dien-2-ylmethanimidothioate

methyl N-hexa-1,3-dien-2-ylmethanimidothioate (PubChem CID 123981750) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is methyl N-hexa-1,3-dien-2-ylmethanimidothioate.

Molecular Properties

Compound Namemethyl N-hexa-1,3-dien-2-ylmethanimidothioate
PubChem CID123981750
Molecular FormulaC8H13NS
Molecular Weight155.27 g/mol
Exact Mass155.08
IUPAC Namemethyl N-hexa-1,3-dien-2-ylmethanimidothioate
SMILESC=C(C=CCC)/N=C/SC
InChIInChI=1S/C8H13NS/c1-4-5-6-8(2)9-7-10-3/h5-7H,2,4H2,1,3H3/b6-5?,9-7+
InChIKeyPYEYDUNDNZJZTD-VFEDGGCQSA-N
XLogP2.86
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.27
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze methyl N-hexa-1,3-dien-2-ylmethanimidothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-hexa-1,3-dien-2-ylmethanimidothioate?
The IUPAC name of methyl N-hexa-1,3-dien-2-ylmethanimidothioate (CID 123981750) is methyl N-hexa-1,3-dien-2-ylmethanimidothioate.
What is the SMILES notation for methyl N-hexa-1,3-dien-2-ylmethanimidothioate?
The canonical SMILES for methyl N-hexa-1,3-dien-2-ylmethanimidothioate is C=C(C=CCC)/N=C/SC.
What is the InChIKey of methyl N-hexa-1,3-dien-2-ylmethanimidothioate?
The InChIKey is PYEYDUNDNZJZTD-VFEDGGCQSA-N. The full InChI is InChI=1S/C8H13NS/c1-4-5-6-8(2)9-7-10-3/h5-7H,2,4H2,1,3H3/b6-5?,9-7+.
What are the key properties of methyl N-hexa-1,3-dien-2-ylmethanimidothioate?
methyl N-hexa-1,3-dien-2-ylmethanimidothioate has a molecular weight of 155.27 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-hexa-1,3-dien-2-ylmethanimidothioate is sourced from PubChem (CID 123981750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).