methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate

C11H17NS — CID 123168665

IUPACmethyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate
SMILESC=C(/N=C/SC)C(C)=CC=CCC
InChIInChI=1S/C11H17NS/c1-5-6-7-8-10(2)11(3)12-9-13-4/h6-9H,3,5H2,1-2,4H3/b7-6?,10-8?,12-9+
InChIKeyUCLGRVZHXRVGJI-IVQLSPEASA-N
MW195.33 g/mol
LogP3.80
Rot. Bonds5

About methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate

methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate (PubChem CID 123168665) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate.

Molecular Properties

Compound Namemethyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate
PubChem CID123168665
Molecular FormulaC11H17NS
Molecular Weight195.33 g/mol
Exact Mass195.11
IUPAC Namemethyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate
SMILESC=C(/N=C/SC)C(C)=CC=CCC
InChIInChI=1S/C11H17NS/c1-5-6-7-8-10(2)11(3)12-9-13-4/h6-9H,3,5H2,1-2,4H3/b7-6?,10-8?,12-9+
InChIKeyUCLGRVZHXRVGJI-IVQLSPEASA-N
XLogP3.80
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.33
LogP ≤ 53.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate?
The IUPAC name of methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate (CID 123168665) is methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate.
What is the SMILES notation for methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate?
The canonical SMILES for methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate is C=C(/N=C/SC)C(C)=CC=CCC.
What is the InChIKey of methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate?
The InChIKey is UCLGRVZHXRVGJI-IVQLSPEASA-N. The full InChI is InChI=1S/C11H17NS/c1-5-6-7-8-10(2)11(3)12-9-13-4/h6-9H,3,5H2,1-2,4H3/b7-6?,10-8?,12-9+.
What are the key properties of methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate?
methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate has a molecular weight of 195.33 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate is sourced from PubChem (CID 123168665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).