C11H17NS — CID 123168665
methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate (PubChem CID 123168665) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate.
| Compound Name | methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate |
|---|---|
| PubChem CID | 123168665 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | methyl N-(3-methylocta-1,3,5-trien-2-yl)methanimidothioate |
| SMILES | C=C(/N=C/SC)C(C)=CC=CCC |
| InChI | InChI=1S/C11H17NS/c1-5-6-7-8-10(2)11(3)12-9-13-4/h6-9H,3,5H2,1-2,4H3/b7-6?,10-8?,12-9+ |
| InChIKey | UCLGRVZHXRVGJI-IVQLSPEASA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|