C12H17NS — CID 123183735
4-hepta-1,3,5-trien-3-yl-1,1-dimethyl-1,3-thiazole (PubChem CID 123183735) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 4-hepta-1,3,5-trien-3-yl-1,1-dimethyl-1,3-thiazole.
| Compound Name | 4-hepta-1,3,5-trien-3-yl-1,1-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 123183735 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-hepta-1,3,5-trien-3-yl-1,1-dimethyl-1,3-thiazole |
| SMILES | C=CC(=CC=CC)C1=CS(C)(C)C=N1 |
| InChI | InChI=1S/C12H17NS/c1-5-7-8-11(6-2)12-9-14(3,4)10-13-12/h5-10H,2H2,1,3-4H3 |
| InChIKey | SUQKYMQQSBLRHY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|