C13H15NO2 — CID 123982166
(8,9-dihydro-7H-benzo[7]annulen-5-ylamino) acetate (PubChem CID 123982166) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (8,9-dihydro-7H-benzo[7]annulen-5-ylamino) acetate.
| Compound Name | (8,9-dihydro-7H-benzo[7]annulen-5-ylamino) acetate |
|---|---|
| PubChem CID | 123982166 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (8,9-dihydro-7H-benzo[7]annulen-5-ylamino) acetate |
| SMILES | CC(=O)ONC1=CCCCc2ccccc21 |
| InChI | InChI=1S/C13H15NO2/c1-10(15)16-14-13-9-5-3-7-11-6-2-4-8-12(11)13/h2,4,6,8-9,14H,3,5,7H2,1H3 |
| InChIKey | PSNUMSHWFAYHTO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|