C17H16FN3O2 — CID 123983825
prop-2-enyl 2-amino-3-cyano-4-(3-fluorophenyl)-6-methyl-3,4-dihydropyridine-5-carboxylate (PubChem CID 123983825) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is prop-2-enyl 2-amino-3-cyano-4-(3-fluorophenyl)-6-methyl-3,4-dihydropyridine-5-carboxylate.
| Compound Name | prop-2-enyl 2-amino-3-cyano-4-(3-fluorophenyl)-6-methyl-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 123983825 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | prop-2-enyl 2-amino-3-cyano-4-(3-fluorophenyl)-6-methyl-3,4-dihydropyridine-5-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=C(N)C(C#N)C1c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FN3O2/c1-3-7-23-17(22)14-10(2)21-16(20)13(9-19)15(14)11-5-4-6-12(18)8-11/h3-6,8,13,15H,1,7H2,2H3,(H2,20,21) |
| InChIKey | DJAWKYMDDAJWQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|