C15H13Cl2N3O — CID 123984314
[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 123984314) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.19 g/mol. Its IUPAC name is [6-(3,4-dichlorophenyl)pyrimidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-(3,4-dichlorophenyl)pyrimidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 123984314 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | [6-(3,4-dichlorophenyl)pyrimidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)c(Cl)c2)ncn1)N1CCCC1 |
| InChI | InChI=1S/C15H13Cl2N3O/c16-11-4-3-10(7-12(11)17)13-8-14(19-9-18-13)15(21)20-5-1-2-6-20/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | XKJJUICVCAWTSA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |