C30H24N4O8 — CID 123984905
4-[5-[4-[3-(carboxymethyl)-2-(4-carboxyphenyl)imidazol-4-yl]phenyl]-1-(2,2-dihydroxyethyl)imidazol-2-yl]benzoic acid (PubChem CID 123984905) has the molecular formula C30H24N4O8 and a molecular weight of 568.54 g/mol. Its IUPAC name is 4-[5-[4-[3-(carboxymethyl)-2-(4-carboxyphenyl)imidazol-4-yl]phenyl]-1-(2,2-dihydroxyethyl)imidazol-2-yl]benzoic acid.
| Compound Name | 4-[5-[4-[3-(carboxymethyl)-2-(4-carboxyphenyl)imidazol-4-yl]phenyl]-1-(2,2-dihydroxyethyl)imidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123984905 |
| Molecular Formula | C30H24N4O8 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 4-[5-[4-[3-(carboxymethyl)-2-(4-carboxyphenyl)imidazol-4-yl]phenyl]-1-(2,2-dihydroxyethyl)imidazol-2-yl]benzoic acid |
| SMILES | O=C(O)Cn1c(-c2ccc(-c3cnc(-c4ccc(C(=O)O)cc4)n3CC(O)O)cc2)cnc1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H24N4O8/c35-25(36)15-33-23(13-31-27(33)19-5-9-21(10-6-19)29(39)40)17-1-2-18(4-3-17)24-14-32-28(34(24)16-26(37)38)20-7-11-22(12-8-20)30(41)42/h1-14,25,35-36H,15-16H2,(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | LABGAIUGJQEOBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|