C11H21N — CID 123985008
(E)-5-methyldec-2-en-4-imine (PubChem CID 123985008) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (E)-5-methyldec-2-en-4-imine.
| Compound Name | (E)-5-methyldec-2-en-4-imine |
|---|---|
| PubChem CID | 123985008 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (E)-5-methyldec-2-en-4-imine |
| SMILES | [H]/N=C(\C=C\C)C(C)CCCCC |
| InChI | InChI=1S/C11H21N/c1-4-6-7-9-10(3)11(12)8-5-2/h5,8,10,12H,4,6-7,9H2,1-3H3/b8-5+,12-11+ |
| InChIKey | PZCXQNONWKWYQS-CQYWEGEGSA-N |
| XLogP | 3.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|