C25H21BF3N3O3 — CID 123986024
CID 123986024 (PubChem CID 123986024) has the molecular formula C25H21BF3N3O3 and a molecular weight of 479.27 g/mol.
| Compound Name | CID 123986024 |
|---|---|
| PubChem CID | 123986024 |
| Molecular Formula | C25H21BF3N3O3 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(CC)c(C(=O)NCc3ccc(OCc4ccc(OC(F)(F)F)cc4)cc3)n2c1 |
| InChI | InChI=1S/C25H21BF3N3O3/c1-2-21-23(32-14-18(26)7-12-22(32)31-21)24(33)30-13-16-3-8-19(9-4-16)34-15-17-5-10-20(11-6-17)35-25(27,28)29/h3-12,14H,2,13,15H2,1H3,(H,30,33) |
| InChIKey | YTBFQSHWGXOEBU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|